EU Specifications  
Acid PS20 (%)a PS80 (%)b Structure
Caproic ≤ 1   CH3(CH2)4COOH
Caprylic ≤ 10   CH3(CH2)6COOH
Capric ≤ 10   CH3(CH2)8COOH
Lauric 40–60   CH3(CH2)10COOH
Myristic 14–25 ≤ 5 CH3(CH2)12COOH
Palmitic 7–15 ≤ 16 CH3(CH2)14COOH
Palmitoleic   ≤ 8 CH3(CH2)5CH=CH(CH2)7COOH
Stearic ≤ 7 ≤ 6 CH3(CH2)16COOH
Oleic ≤ 11 ≥ 58 CH3(CH2)7CH=CH(CH2)7COOH
Linoleic ≤ 3 ≤ 18 CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
Linolenic   ≤ 4 CH3(CH2)4CH=CHCH2CH=CH CH2CH=CH (CH2)4COOH
aEuropean Pharmacopoeia 8.0, 07/2015:0426; bEuropean Pharmacopoeia 8.0, 01/2011:0428
Table 3: PS20 and PS80 composition of fatty acids.